| Compound Information | SONAR Target prediction |
| Name: | GANGALEOIDIN |
| Unique Identifier: | SPE00200035 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | |
| Molecular Weight: | 399.094 g/mol |
| X log p: | 4.46 (online calculus) |
| Lipinksi Failures | 0 |
| TPSA | 71.06 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 7 |
| Rotatable Bond Count: | 3 |
| Canonical Smiles: | COC(=O)c1c(C)c2Oc3c(Cl)c(O)c(Cl)c(C)c3C(=O)Oc2cc1OC |
| Class: | depsidone |
| Source: | Lecanora gangaleoides |
| Reference: | J Chem Soc 1986: 1491 |
| Found: 192 nonactive | as graph: single | with analogs | [1] << Back 11 12 13 14 15 16 17 18 19 20 Next >> [192] |
| Species: | 4932 |
| Condition: | DIA2 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.6117±0.000919239 |
| Normalized OD Score: sc h | 0.9923±0.00370178 |
| Z-Score: | -0.3573±0.180906 |
| p-Value: | 0.723016 |
| Z-Factor: | -37.4047 |
| Fitness Defect: | 0.3243 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 1 |
| 4565183 |
| internal high similarity DBLink | Rows returned: 3 |
| SPE00300222 | 0.9235 |
| SPE00200033 | 0.9326 |
| SPE00241150 | 0.9389 |
| active | Cluster 8052 | Additional Members: 2 | Rows returned: 0 |
Service provided by the
Mike Tyers Laboratory