| Compound Information | SONAR Target prediction |
| Name: | LEOIDIN |
| Unique Identifier: | SPE00200033 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | |
| Molecular Weight: | 399.094 g/mol |
| X log p: | 2.513 (online calculus) |
| Lipinksi Failures | 0 |
| TPSA | 61.83 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 7 |
| Rotatable Bond Count: | 2 |
| Canonical Smiles: | COC(=O)c1c(C)c2Oc3c(Cl)c(O)c(Cl)c(C)c3C(=O)Oc2c(C)c1O |
| Class: | depsidone |
| Source: | lichen metabolite |
| Reference: | J Chem Soc 1986: 1491 |
| Found: 425 nonactive | as graph: single | with analogs | [1] << Back 331 332 333 334 335 336 337 338 339 340 Next >> [425] |
| Species: | 4932 |
| Condition: | CIN8 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.6448±0.0150614 |
| Normalized OD Score: sc h | 0.9737±0.0185801 |
| Z-Score: | -0.7653±1.02397 |
| p-Value: | 0.551754 |
| Z-Factor: | -4.94418 |
| Fitness Defect: | 0.5947 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 1 |
| 3503223 |
| internal high similarity DBLink | Rows returned: 2 |
| SPE00200035 | 0.9326 |
| SPE00241150 | 0.9722 |
| active | Cluster 259 | Additional Members: 4 | Rows returned: 2 |
| SPE01400422 | 0.442622950819672 |
| SPE00241150 | 0 |
Service provided by the
Mike Tyers Laboratory