| Compound Information | SONAR Target prediction | | Name: | MUNDULONE | | Unique Identifier: | SPE00200011 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C26H26O6 | | Molecular Weight: | 408.275 g/mol | | X log p: | (online calculus) | | Lipinksi Failures | | | TPSA | | | Hydrogen Bond Donor Count: | | | Hydrogen Bond Acceptors Count: | | | Rotatable Bond Count: | | | Canonical Smiles: | COc1c2C=CC(C)(C)Oc2ccc1C1=COc2cc3OC(C)(C)C(O)Cc3cc2C1=O | | Class: | isoflavone | | Source: | Mundulea sericea | | Reference: | Tet Letters 1963, 281 |
| Species: |
4932 |
| Condition: |
MT2481-pdr1pdr3-2nd |
| Replicates: |
2 |
| Raw OD Value: r im |
0.0738±0.00678822 |
| Normalized OD Score: sc h |
0.1256±0.0105047 |
| Z-Score: |
-36.7759±0.0951725 |
| p-Value: |
0 |
| Z-Factor: |
0.901729 |
| Fitness Defect: |
INF |
| Bioactivity Statement: |
Toxic |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 10|A3 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.80 Celcius | | Date: | 2008-08-22 YYYY-MM-DD | | Plate CH Control (+): | 0.040225±0.00066 | | Plate DMSO Control (-): | 0.57525±0.01048 | | Plate Z-Factor: | 0.9366 |
|  png
ps
pdf |
| DBLink | Rows returned: 0 | |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 2161 | Additional Members: 6 | Rows returned: 2 | |
|
