Compound Information | SONAR Target prediction | Name: | MUNDULONE | Unique Identifier: | SPE00200011 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C26H26O6 | Molecular Weight: | 408.275 g/mol | X log p: | (online calculus) | Lipinksi Failures | | TPSA | | Hydrogen Bond Donor Count: | | Hydrogen Bond Acceptors Count: | | Rotatable Bond Count: | | Canonical Smiles: | COc1c2C=CC(C)(C)Oc2ccc1C1=COc2cc3OC(C)(C)C(O)Cc3cc2C1=O | Class: | isoflavone | Source: | Mundulea sericea | Reference: | Tet Letters 1963, 281 |
Species: |
4932 |
Condition: |
BY4741-2nd |
Replicates: |
2 |
Raw OD Value: r im |
0.9380±0.00657609 |
Normalized OD Score: sc h |
0.9654±0.00656303 |
Z-Score: |
-0.8546±0.342558 |
p-Value: |
0.406514 |
Z-Factor: |
-4.81919 |
Fitness Defect: |
0.9001 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum_ED | Plate Number and Position: | 15|C5 | Drug Concentration: | 50.00 nM | OD Absorbance: | 595 nm | Robot Temperature: | 30.00 Celcius | Date: | 2012-05-28 YYYY-MM-DD | Plate CH Control (+): | 0.09350000000000001±0.00762 | Plate DMSO Control (-): | 0.9465000000000001±0.03346 | Plate Z-Factor: | 0.8555 |
| png ps pdf |
DBLink | Rows returned: 0 | |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 2161 | Additional Members: 6 | Rows returned: 2 | |
|