| Compound Information | SONAR Target prediction | | Name: | MUNDULONE | | Unique Identifier: | SPE00200011 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C26H26O6 | | Molecular Weight: | 408.275 g/mol | | X log p: | (online calculus) | | Lipinksi Failures | | | TPSA | | | Hydrogen Bond Donor Count: | | | Hydrogen Bond Acceptors Count: | | | Rotatable Bond Count: | | | Canonical Smiles: | COc1c2C=CC(C)(C)Oc2ccc1C1=COc2cc3OC(C)(C)C(O)Cc3cc2C1=O | | Class: | isoflavone | | Source: | Mundulea sericea | | Reference: | Tet Letters 1963, 281 |
| Species: |
4932 |
| Condition: |
WHI5 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6943±0.0168291 |
| Normalized OD Score: sc h |
0.9780±0.0145777 |
| Z-Score: |
-0.6653±0.471993 |
| p-Value: |
0.529028 |
| Z-Factor: |
-3.97513 |
| Fitness Defect: |
0.6367 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 10|A3 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.60 Celcius | | Date: | 2008-09-16 YYYY-MM-DD | | Plate CH Control (+): | 0.042249999999999996±0.01254 | | Plate DMSO Control (-): | 0.705625±0.01408 | | Plate Z-Factor: | 0.8176 |
|  png
ps
pdf |
| DBLink | Rows returned: 0 | |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 2161 | Additional Members: 6 | Rows returned: 2 | |
|
