Compound Information | SONAR Target prediction | Name: | MUNDULONE | Unique Identifier: | SPE00200011 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C26H26O6 | Molecular Weight: | 408.275 g/mol | X log p: | (online calculus) | Lipinksi Failures | | TPSA | | Hydrogen Bond Donor Count: | | Hydrogen Bond Acceptors Count: | | Rotatable Bond Count: | | Canonical Smiles: | COc1c2C=CC(C)(C)Oc2ccc1C1=COc2cc3OC(C)(C)C(O)Cc3cc2C1=O | Class: | isoflavone | Source: | Mundulea sericea | Reference: | Tet Letters 1963, 281 |
Species: |
4932 |
Condition: |
SSE1 |
Replicates: |
2 |
Raw OD Value: r im |
0.4879±0.0227688 |
Normalized OD Score: sc h |
1.0118±0.00602661 |
Z-Score: |
0.3169±0.175454 |
p-Value: |
0.753156 |
Z-Factor: |
-632.068 |
Fitness Defect: |
0.2835 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 10|A3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 23.60 Celcius | Date: | 2008-05-01 YYYY-MM-DD | Plate CH Control (+): | 0.04085±0.00065 | Plate DMSO Control (-): | 0.437775±0.02745 | Plate Z-Factor: | 0.7552 |
| png ps pdf |
DBLink | Rows returned: 0 | |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 2161 | Additional Members: 6 | Rows returned: 2 | |
|