Compound Information | SONAR Target prediction | Name: | MUNDULONE | Unique Identifier: | SPE00200011 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C26H26O6 | Molecular Weight: | 408.275 g/mol | X log p: | (online calculus) | Lipinksi Failures | | TPSA | | Hydrogen Bond Donor Count: | | Hydrogen Bond Acceptors Count: | | Rotatable Bond Count: | | Canonical Smiles: | COc1c2C=CC(C)(C)Oc2ccc1C1=COc2cc3OC(C)(C)C(O)Cc3cc2C1=O | Class: | isoflavone | Source: | Mundulea sericea | Reference: | Tet Letters 1963, 281 |
Species: |
4932 |
Condition: |
DOA4 |
Replicates: |
2 |
Raw OD Value: r im |
0.6739±0.0101823 |
Normalized OD Score: sc h |
1.0017±0.00768968 |
Z-Score: |
0.0745±0.314235 |
p-Value: |
0.82464 |
Z-Factor: |
-29.9213 |
Fitness Defect: |
0.1928 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 10|A3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 23.80 Celcius | Date: | 2008-05-02 YYYY-MM-DD | Plate CH Control (+): | 0.041499999999999995±0.00213 | Plate DMSO Control (-): | 0.646325±0.01704 | Plate Z-Factor: | 0.9058 |
| png ps pdf |
DBLink | Rows returned: 0 | |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 2161 | Additional Members: 6 | Rows returned: 2 | |
|