Compound Information | SONAR Target prediction | Name: | ANDROSTERONE ACETATE | Unique Identifier: | SPE00107113 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 301.231 g/mol | X log p: | -0.0390000000000001 (online calculus) | Lipinksi Failures | 0 | TPSA | 43.37 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 2 | Canonical Smiles: | CC(=O)OC1CCC2(C)C(CCC3C2CCC2(C)C3CCC2=O)C1 | Source: | semisynthetic | Therapeutics: | androgen |
Species: |
4932 |
Condition: |
VPS1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6282±0.0295571 |
Normalized OD Score: sc h |
0.9843±0.0146706 |
Z-Score: |
-0.6307±0.601419 |
p-Value: |
0.564078 |
Z-Factor: |
-23.8783 |
Fitness Defect: |
0.5726 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 9|A8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.90 Celcius | Date: | 2007-10-03 YYYY-MM-DD | Plate CH Control (+): | 0.040175±0.00097 | Plate DMSO Control (-): | 0.621425±0.06173 | Plate Z-Factor: | 0.6453 |
| png ps pdf |
14419 |
[(10S,13S,17S)-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenant hren-17-yl] acetate |
101996 |
[(3R,5S,8R,9S,10S,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopen ta[a]phenanthren-3-yl] acetate |
107497 |
[(1S,5S,8S,9S,10S,13S,14S,17S)-1,10,13-trimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydroc yclopenta[a]phenanthren-17-yl] acetate |
109201 |
calcium 12-acetyloxyoctadecanoate |
109202 |
12-acetyloxyoctadecanoic acid |
155547 |
[(2R,5S,8S,9S,10S,13S,14S,17S)-2,10,13-trimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydroc yclopenta[a]phenanthren-17-yl] acetate |
internal high similarity DBLink | Rows returned: 10 | 1 2 Next >> |
active | Cluster 11774 | Additional Members: 14 | Rows returned: 5 | |
|