| Compound Information | SONAR Target prediction |  | Name: | ANDROSTERONE ACETATE |  | Unique Identifier: | SPE00107113  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 301.231 g/mol |  | X log p: | -0.0390000000000001  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 43.37 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 3 |  | Rotatable Bond Count: | 2 |  | Canonical Smiles: | CC(=O)OC1CCC2(C)C(CCC3C2CCC2(C)C3CCC2=O)C1 |  | Source: | semisynthetic |  | Therapeutics: | androgen |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		ELG1 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.7191±0.00919239 | 
	 
	
		| Normalized OD Score: sc h | 
		1.0020±0.00797062 | 
	 
	
		| Z-Score: | 
		0.1254±0.498132 | 
	 
	
		| p-Value: | 
		0.726732 | 
	 
	
		| Z-Factor: | 
		-19.7366 | 
	 
	
		| Fitness Defect: | 
		0.3192 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 9|A8 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 25.00 Celcius |  | Date: | 2007-10-10 YYYY-MM-DD |  | Plate CH Control (+): | 0.040525000000000005±0.00066 |  | Plate DMSO Control (-): | 0.7041999999999999±0.02004 |  | Plate Z-Factor: | 0.9008 |  
  |  png ps pdf |  
 
 
	
		| 14419 | 
		[(10S,13S,17S)-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenant hren-17-yl] acetate | 
	 
	
		| 101996 | 
		[(3R,5S,8R,9S,10S,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopen ta[a]phenanthren-3-yl] acetate | 
	 
	
		| 107497 | 
		[(1S,5S,8S,9S,10S,13S,14S,17S)-1,10,13-trimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydroc yclopenta[a]phenanthren-17-yl] acetate | 
	 
	
		| 109201 | 
		calcium 12-acetyloxyoctadecanoate | 
	 
	
		| 109202 | 
		12-acetyloxyoctadecanoic acid | 
	 
	
		| 155547 | 
		[(2R,5S,8S,9S,10S,13S,14S,17S)-2,10,13-trimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydroc yclopenta[a]phenanthren-17-yl] acetate | 
	 
 
 | internal high similarity DBLink  | Rows returned: 10 | 1 2 Next >>  |   
 |  active | Cluster 11774 | Additional Members: 14 | Rows returned: 5 |  |   
 
 |