Compound Information | SONAR Target prediction | Name: | ANDROSTERONE ACETATE | Unique Identifier: | SPE00107113 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 301.231 g/mol | X log p: | -0.0390000000000001 (online calculus) | Lipinksi Failures | 0 | TPSA | 43.37 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 2 | Canonical Smiles: | CC(=O)OC1CCC2(C)C(CCC3C2CCC2(C)C3CCC2=O)C1 | Source: | semisynthetic | Therapeutics: | androgen |
Species: |
4932 |
Condition: |
POP2 |
Replicates: |
2 |
Raw OD Value: r im |
0.5712±0.0321026 |
Normalized OD Score: sc h |
0.8765±0.0101983 |
Z-Score: |
-5.7706±0.00571737 |
p-Value: |
0.00000000789912 |
Z-Factor: |
-1.21823 |
Fitness Defect: |
18.6565 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 9|A8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.90 Celcius | Date: | 2007-10-24 YYYY-MM-DD | Plate CH Control (+): | 0.040875±0.00070 | Plate DMSO Control (-): | 0.642925±0.04572 | Plate Z-Factor: | 0.7473 |
| png ps pdf |
537145 |
9-oxononyl acetate |
537181 |
methyl 9-acetyloxyhenicosanoate |
537188 |
methyl 4-(3,12-diacetyloxy-2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17-hexadecahydro-1H-cyclopenta[a]phenanthren-17 -yl)pentanoate |
537634 |
[4,4,10,13,14-pentamethyl-17-(6-methylheptan-2-yl)-11-oxo-1,2,3,5,6,7,8,9,12,15,16,17-dodecahydrocyclope nta[a]phenanthren-3-yl] acetate |
537642 |
(2-methyl-6-oxo-heptyl) acetate |
537924 |
methyl 8-acetyloxyoctanoate |
internal high similarity DBLink | Rows returned: 10 | 1 2 Next >> |
active | Cluster 11774 | Additional Members: 14 | Rows returned: 5 | |
|