Compound Information | SONAR Target prediction | Name: | ANDROSTERONE ACETATE | Unique Identifier: | SPE00107113 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 301.231 g/mol | X log p: | -0.0390000000000001 (online calculus) | Lipinksi Failures | 0 | TPSA | 43.37 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 2 | Canonical Smiles: | CC(=O)OC1CCC2(C)C(CCC3C2CCC2(C)C3CCC2=O)C1 | Source: | semisynthetic | Therapeutics: | androgen |
Species: |
4932 |
Condition: |
AAT2 |
Replicates: |
2 |
Raw OD Value: r im |
0.7010±0.0277893 |
Normalized OD Score: sc h |
0.9623±0.0235376 |
Z-Score: |
-1.9867±1.20604 |
p-Value: |
0.130672 |
Z-Factor: |
-2.41108 |
Fitness Defect: |
2.0351 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 9|A6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.10 Celcius | Date: | 2008-04-08 YYYY-MM-DD | Plate CH Control (+): | 0.0403±0.00082 | Plate DMSO Control (-): | 0.7129749999999999±0.01080 | Plate Z-Factor: | 0.9359 |
| png ps pdf |
7213804 |
[(1R)-1-[(5S,8R,9R,10S,13R,14S,17R)-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydr ocyclopenta[a]phenanthren-17-yl]ethyl] acetate |
7213805 |
[(1S)-1-[(5S,8R,9R,10S,13R,14S,17S)-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydr ocyclopenta[a]phenanthren-17-yl]ethyl] acetate |
7213808 |
[(1R)-1-[(5S,8R,9R,10S,13R,14S,17S)-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydr ocyclopenta[a]phenanthren-17-yl]ethyl] acetate |
7542689 |
[(3S,5S,8S,9R,10S,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopen ta[a]phenanthren-3-yl] acetate |
7542691 |
[(3S,5S,8S,9S,10S,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopen ta[a]phenanthren-3-yl] acetate |
9496938 |
methyl (4R)-4-[(3R,5R,8S,9S,10S,12S,13R,14S,17R)-3-acetyloxy-12-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14 ,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
internal high similarity DBLink | Rows returned: 10 | 1 2 Next >> |
active | Cluster 11774 | Additional Members: 14 | Rows returned: 5 | |
|