| Compound Information | SONAR Target prediction | | Name: | ANDROSTERONE ACETATE | | Unique Identifier: | SPE00107113 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 301.231 g/mol | | X log p: | -0.0390000000000001 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 43.37 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 3 | | Rotatable Bond Count: | 2 | | Canonical Smiles: | CC(=O)OC1CCC2(C)C(CCC3C2CCC2(C)C3CCC2=O)C1 | | Source: | semisynthetic | | Therapeutics: | androgen |
| Species: |
4932 |
| Condition: |
NBP2 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.5034±0.0268701 |
| Normalized OD Score: sc h |
0.6607±0.00388625 |
| Z-Score: |
-8.4732±1.31359 |
| p-Value: |
0.0000000000000227222 |
| Z-Factor: |
0.71302 |
| Fitness Defect: |
31.4154 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 9|A8 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.30 Celcius | | Date: | 2006-02-17 YYYY-MM-DD | | Plate CH Control (+): | 0.038025±0.00119 | | Plate DMSO Control (-): | 0.715525±0.02095 | | Plate Z-Factor: | 0.9296 |
| png ps pdf |
| 7091819 |
[(5S,8S,9R,10S,13S,14R,17S)-10,13,17-trimethyl-3-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclope nta[a]phenanthren-17-yl] acetate |
| 7091820 |
[(5S,8S,9S,10S,13S,14S,17S)-10,13,17-trimethyl-3-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclope nta[a]phenanthren-17-yl] acetate |
| 7091821 |
[(5S,8S,9S,10S,13S,14R,17S)-10,13,17-trimethyl-3-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclope nta[a]phenanthren-17-yl] acetate |
| 7092647 |
[(3R,5S,8R,9R,10S,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopen ta[a]phenanthren-3-yl] acetate |
| 7092648 |
[(3R,5S,8R,9S,10S,13S,14R)-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopen ta[a]phenanthren-3-yl] acetate |
| 7099975 |
(3S,5S,8R,9R,10S,13R,14R,17R)-3-acetyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydr o-1H-cyclopenta[a]phenanthrene-17-carboxylate |
| internal high similarity DBLink | Rows returned: 10 | 1 2 Next >> |
| active | Cluster 11774 | Additional Members: 14 | Rows returned: 5 | |
|