Compound Information | SONAR Target prediction | Name: | ANDROSTERONE ACETATE | Unique Identifier: | SPE00107113 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 301.231 g/mol | X log p: | -0.0390000000000001 (online calculus) | Lipinksi Failures | 0 | TPSA | 43.37 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 2 | Canonical Smiles: | CC(=O)OC1CCC2(C)C(CCC3C2CCC2(C)C3CCC2=O)C1 | Source: | semisynthetic | Therapeutics: | androgen |
Species: |
4932 |
Condition: |
HHF1 |
Replicates: |
2 |
Raw OD Value: r im |
0.5998±0.0436992 |
Normalized OD Score: sc h |
0.8661±0.0221747 |
Z-Score: |
-5.8007±0.700646 |
p-Value: |
0.0000000563948 |
Z-Factor: |
-0.23327 |
Fitness Defect: |
16.6909 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 9|A6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 23.70 Celcius | Date: | 2008-04-15 YYYY-MM-DD | Plate CH Control (+): | 0.040825±0.00098 | Plate DMSO Control (-): | 0.6932750000000001±0.02151 | Plate Z-Factor: | 0.8747 |
| png ps pdf |
7052836 |
[(3R,5S,8R,9S,10S,13S,14R,16R)-10,13,16-trimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydro cyclopenta[a]phenanthren-3-yl] acetate |
7052837 |
[(3R,5S,8R,9S,10S,13S,14R,16S)-10,13,16-trimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydro cyclopenta[a]phenanthren-3-yl] acetate |
7052838 |
[(3R,5S,8R,9S,10S,13S,14S,16R)-10,13,16-trimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydro cyclopenta[a]phenanthren-3-yl] acetate |
7052839 |
[(3R,5S,8R,9S,10S,13S,14S,16S)-10,13,16-trimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydro cyclopenta[a]phenanthren-3-yl] acetate |
7052887 |
[(5R,7R,8S,9S,10R,13R,14S,17S)-7,10,13-trimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydroc yclopenta[a]phenanthren-17-yl] acetate |
7052888 |
[(5S,7R,8S,9S,10R,13R,14S,17S)-7,10,13-trimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydroc yclopenta[a]phenanthren-17-yl] acetate |
internal high similarity DBLink | Rows returned: 10 | 1 2 Next >> |
active | Cluster 11774 | Additional Members: 14 | Rows returned: 5 | |
|