Compound Information | SONAR Target prediction | Name: | ANDROSTERONE ACETATE | Unique Identifier: | SPE00107113 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 301.231 g/mol | X log p: | -0.0390000000000001 (online calculus) | Lipinksi Failures | 0 | TPSA | 43.37 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 2 | Canonical Smiles: | CC(=O)OC1CCC2(C)C(CCC3C2CCC2(C)C3CCC2=O)C1 | Source: | semisynthetic | Therapeutics: | androgen |
Species: |
4932 |
Condition: |
RRP6 |
Replicates: |
2 |
Raw OD Value: r im |
0.5614±0.014425 |
Normalized OD Score: sc h |
0.8908±0.0107844 |
Z-Score: |
-4.0142±0.565305 |
p-Value: |
0.000155587 |
Z-Factor: |
-0.0901729 |
Fitness Defect: |
8.7683 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 9|A6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 22.60 Celcius | Date: | 2008-03-14 YYYY-MM-DD | Plate CH Control (+): | 0.0407±0.00093 | Plate DMSO Control (-): | 0.6168750000000001±0.01740 | Plate Z-Factor: | 0.8726 |
| png ps pdf |
6432116 |
[(3R,5S)-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3 -yl] acetate |
6455695 |
8-acetyloxyoctyl acetate; hexanedioic acid |
6541181 |
[(3R,5S,8R,9R,10R,13R,14S)-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopen ta[a]phenanthren-3-yl] acetate |
6546124 |
[(5S,8R,9R,10R,13R,14S,17R)-10,13,17-trimethyl-3-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclope nta[a]phenanthren-17-yl] acetate |
6546263 |
[(5S,8R,9R,10R,13R,14S,17R)-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclope nta[a]phenanthren-17-yl] acetate |
6548077 |
n/a |
internal high similarity DBLink | Rows returned: 10 | 1 2 Next >> |
active | Cluster 11774 | Additional Members: 14 | Rows returned: 5 | |
|