Compound Information | SONAR Target prediction | Name: | ANDROSTERONE ACETATE | Unique Identifier: | SPE00107113 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 301.231 g/mol | X log p: | -0.0390000000000001 (online calculus) | Lipinksi Failures | 0 | TPSA | 43.37 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 2 | Canonical Smiles: | CC(=O)OC1CCC2(C)C(CCC3C2CCC2(C)C3CCC2=O)C1 | Source: | semisynthetic | Therapeutics: | androgen |
Species: |
4932 |
Condition: |
MT2481-pdr1pdr3-2nd |
Replicates: |
2 |
Raw OD Value: r im |
0.2716±0.028355 |
Normalized OD Score: sc h |
0.6388±0.0568498 |
Z-Score: |
-8.7343±2.94128 |
p-Value: |
0.0000000000142183 |
Z-Factor: |
-2.3237 |
Fitness Defect: |
24.9765 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 9|A6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.80 Celcius | Date: | 2008-08-22 YYYY-MM-DD | Plate CH Control (+): | 0.040124999999999994±0.00055 | Plate DMSO Control (-): | 0.5677500000000001±0.00837 | Plate Z-Factor: | 0.9501 |
| png ps pdf |
6427594 |
[(2S)-6-oxodecalin-2-yl] acetate |
6428101 |
methyl 4-[(3R,5R,12R)-3,12-diacetyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclo penta[a]phenanthren-17-yl]pentanoate |
6428248 |
[(5S,10S,13S,17R)-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phen anthren-17-yl] acetate |
6428265 |
[(5R,10S,13S,17R)-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phen anthren-17-yl] acetate |
6428274 |
[(5R,10S,13S,17S)-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phen anthren-17-yl] acetate |
6429337 |
2-[(2S)-8-oxodecalin-2-yl]propyl acetate |
internal high similarity DBLink | Rows returned: 10 | 1 2 Next >> |
active | Cluster 11774 | Additional Members: 14 | Rows returned: 5 | |
|