Compound Information | SONAR Target prediction | Name: | ANDROSTERONE ACETATE | Unique Identifier: | SPE00107113 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 301.231 g/mol | X log p: | -0.0390000000000001 (online calculus) | Lipinksi Failures | 0 | TPSA | 43.37 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 2 | Canonical Smiles: | CC(=O)OC1CCC2(C)C(CCC3C2CCC2(C)C3CCC2=O)C1 | Source: | semisynthetic | Therapeutics: | androgen |
Species: |
4932 |
Condition: |
RAD52 |
Replicates: |
2 |
Raw OD Value: r im |
0.5672±0.0393858 |
Normalized OD Score: sc h |
0.8849±0.0405451 |
Z-Score: |
-4.8576±1.76225 |
p-Value: |
0.00015221 |
Z-Factor: |
-1.13181 |
Fitness Defect: |
8.7902 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 9|A8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 23.50 Celcius | Date: | 2007-10-26 YYYY-MM-DD | Plate CH Control (+): | 0.041325±0.00048 | Plate DMSO Control (-): | 0.6229750000000001±0.02341 | Plate Z-Factor: | 0.8764 |
| png ps pdf |
250210 |
[(3S,5S,8R,9S,10S,13R,14S,17S)-17-acetyl-4,4,10,13,14-pentamethyl-2,3,5,6,7,8,9,11,12,15,16,17-dodecahyd ro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
250213 |
[(5S,8R,9S,10S,13S,14S,17S)-4,4,10,13,14-pentamethyl-3-oxo-1,2,5,6,7,8,9,11,12,15,16,17-dodecahydrocyclo penta[a]phenanthren-17-yl] acetate |
252015 |
(10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl) acetate |
252814 |
n/a |
253635 |
[(3S,5S,8R,9S,10S,13S,14S)-4,4,10,13,14-pentamethyl-17-oxo-1,2,3,5,6,7,8,9,11,12,15,16-dodecahydrocyclop enta[a]phenanthren-3-yl] acetate |
254637 |
n/a |
internal high similarity DBLink | Rows returned: 10 | 1 2 Next >> |
active | Cluster 11774 | Additional Members: 14 | Rows returned: 5 | |
|