| Compound Information | SONAR Target prediction | | Name: | ANDROSTERONE ACETATE | | Unique Identifier: | SPE00107113 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 301.231 g/mol | | X log p: | -0.0390000000000001 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 43.37 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 3 | | Rotatable Bond Count: | 2 | | Canonical Smiles: | CC(=O)OC1CCC2(C)C(CCC3C2CCC2(C)C3CCC2=O)C1 | | Source: | semisynthetic | | Therapeutics: | androgen |
| Species: |
4932 |
| Condition: |
PEX11 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6042±0.0506288 |
| Normalized OD Score: sc h |
0.8649±0.0694118 |
| Z-Score: |
-7.7271±3.38366 |
| p-Value: |
0.000000047896 |
| Z-Factor: |
-1.43375 |
| Fitness Defect: |
16.8542 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 9|A8 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.50 Celcius | | Date: | 2007-10-23 YYYY-MM-DD | | Plate CH Control (+): | 0.039175±0.00079 | | Plate DMSO Control (-): | 0.683675±0.02486 | | Plate Z-Factor: | 0.8697 |
|  png
ps
pdf |
| 2754269 |
methyl
(4S)-4-[(3R,5R,10S,12S,13R,17R)-3,12-diacetyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetrad
ecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| 2755046 |
(3S)-5-[(1R,2R,8aR)-2-acetyloxy-2,5,5,8a-tetramethyl-decalin-1-yl]-3-methyl-pentanoic acid |
| 2755048 |
methyl (3S)-5-[(1R,2R,8aR)-2-acetyloxy-2,5,5,8a-tetramethyl-decalin-1-yl]-3-methyl-pentanoate |
| 2825516 |
(10,13-dimethyl-1-oxo-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)
acetate |
| 2825571 |
1-[(5S)-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17
-yl]ethyl acetate |
| 3022911 |
ethyl 8-acetyloxyoctanoate |
| internal high similarity DBLink | Rows returned: 10 | 1 2 Next >> |
| active | Cluster 11774 | Additional Members: 14 | Rows returned: 5 | |
|
