Compound Information | SONAR Target prediction | Name: | ANDROSTERONE ACETATE | Unique Identifier: | SPE00107113 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 301.231 g/mol | X log p: | -0.0390000000000001 (online calculus) | Lipinksi Failures | 0 | TPSA | 43.37 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 2 | Canonical Smiles: | CC(=O)OC1CCC2(C)C(CCC3C2CCC2(C)C3CCC2=O)C1 | Source: | semisynthetic | Therapeutics: | androgen |
Species: |
4932 |
Condition: |
PRE9 |
Replicates: |
2 |
Raw OD Value: r im |
0.5570±0.0258094 |
Normalized OD Score: sc h |
0.8760±0.0169269 |
Z-Score: |
-4.7191±0.702779 |
p-Value: |
0.0000121911 |
Z-Factor: |
-1.35422 |
Fitness Defect: |
11.3148 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 9|A8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.70 Celcius | Date: | 2007-10-04 YYYY-MM-DD | Plate CH Control (+): | 0.0398±0.00036 | Plate DMSO Control (-): | 0.6257999999999999±0.04223 | Plate Z-Factor: | 0.7754 |
| png ps pdf |
631371 |
(4,4,6a,8a,11,12,14b-heptamethyl-13-oxo-2,3,4a,5,6,6a,6b,7,8,9,10,11,12,12a,14,14a-hexadecahydro-1H-pice n-3-yl) acetate |
631387 |
(4,4,6a,8a,11,11,14b-heptamethyl-13-oxo-1,2,3,4a,5,6,6a,6b,7,8,9,10,12,12a,14,14a-hexadecahydropicen-3-y l) acetate |
632027 |
4-(3,12-diacetyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phen anthren-17-yl)pentanoic acid |
632279 |
(4,4,10,13-tetramethyl-3-oxo-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl ) acetate |
632419 |
methyl 10-acetyloxy-2,2,4a,6a,8a,9,14a-heptamethyl-1,3,4,5,6,6b,7,8,9,10,11,12,12a,13,14,14b-hexadecahydropicen e-6a-carboxylate |
633420 |
[10,13-dimethyl-17-(6-methylheptan-2-yl)-11-oxo-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahydrocyclopent a[a]phenanthren-3-yl] acetate |
internal high similarity DBLink | Rows returned: 10 | 1 2 Next >> |
active | Cluster 11774 | Additional Members: 14 | Rows returned: 5 | |
|