Compound Information | SONAR Target prediction | Name: | ANDROSTERONE ACETATE | Unique Identifier: | SPE00107113 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 301.231 g/mol | X log p: | -0.0390000000000001 (online calculus) | Lipinksi Failures | 0 | TPSA | 43.37 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 2 | Canonical Smiles: | CC(=O)OC1CCC2(C)C(CCC3C2CCC2(C)C3CCC2=O)C1 | Source: | semisynthetic | Therapeutics: | androgen |
Species: |
4932 |
Condition: |
SAM2 |
Replicates: |
2 |
Raw OD Value: r im |
0.5753±0.0688722 |
Normalized OD Score: sc h |
0.8828±0.0768389 |
Z-Score: |
-5.9728±3.99313 |
p-Value: |
0.000818638 |
Z-Factor: |
-3.76469 |
Fitness Defect: |
7.1079 |
Bioactivity Statement: |
Outlier |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 9|A8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.30 Celcius | Date: | 2007-09-21 YYYY-MM-DD | Plate CH Control (+): | 0.03985±0.00032 | Plate DMSO Control (-): | 0.643275±0.04847 | Plate Z-Factor: | 0.7235 |
| png ps pdf |
540806 |
n/a |
540888 |
(10,13,17-trimethyl-3-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl) acetate |
541039 |
1-(10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)e thyl acetate |
545691 |
n/a |
564192 |
2-(3-oxo-7-bicyclo[3.2.1]octyl)ethyl acetate |
565634 |
(4,4,6a,6b,8a,11,12,14b-octamethyl-13-oxo-1,2,3,4a,5,6,6a,7,8,9,10,11,12,12a,14,14a-hexadecahydropicen-3 -yl) acetate |
internal high similarity DBLink | Rows returned: 10 | 1 2 Next >> |
active | Cluster 11774 | Additional Members: 14 | Rows returned: 5 | |
|