| Compound Information | SONAR Target prediction | | Name: | ANDROSTERONE ACETATE | | Unique Identifier: | SPE00107113 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 301.231 g/mol | | X log p: | -0.0390000000000001 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 43.37 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 3 | | Rotatable Bond Count: | 2 | | Canonical Smiles: | CC(=O)OC1CCC2(C)C(CCC3C2CCC2(C)C3CCC2=O)C1 | | Source: | semisynthetic | | Therapeutics: | androgen |
| Species: |
4932 |
| Condition: |
HHF1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.5998±0.0436992 |
| Normalized OD Score: sc h |
0.8661±0.0221747 |
| Z-Score: |
-5.8007±0.700646 |
| p-Value: |
0.0000000563948 |
| Z-Factor: |
-0.23327 |
| Fitness Defect: |
16.6909 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 9|A6 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 23.70 Celcius | | Date: | 2008-04-15 YYYY-MM-DD | | Plate CH Control (+): | 0.040825±0.00098 | | Plate DMSO Control (-): | 0.6932750000000001±0.02151 | | Plate Z-Factor: | 0.8747 |
| png ps pdf |
| 537925 |
methyl 11-acetyloxyhexadecanoate |
| 537935 |
methyl 15-acetyloxyhexadecanoate |
| 537951 |
methyl 10-acetyloxyhexadecanoate |
| 538065 |
(2,10,13-trimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl) acetate |
| 538071 |
methyl 4-(3-acetyloxy-10-methyl-12-oxo-2,3,4,5,6,7,8,9,11,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenant hren-17-yl)pentanoate |
| 538122 |
[10,13-dimethyl-12-oxo-17-(5-oxopentan-2-yl)-1,2,3,4,5,6,7,8,9,11,14,15,16,17-tetradecahydrocyclopenta[a ]phenanthren-3-yl] acetate |
| internal high similarity DBLink | Rows returned: 10 | 1 2 Next >> |
|