Compound Information | SONAR Target prediction | Name: | ANDROSTERONE ACETATE | Unique Identifier: | SPE00107113 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 301.231 g/mol | X log p: | -0.0390000000000001 (online calculus) | Lipinksi Failures | 0 | TPSA | 43.37 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 2 | Canonical Smiles: | CC(=O)OC1CCC2(C)C(CCC3C2CCC2(C)C3CCC2=O)C1 | Source: | semisynthetic | Therapeutics: | androgen |
Species: |
4932 |
Condition: |
MCK1 |
Replicates: |
2 |
Raw OD Value: r im |
0.5112±0.0212839 |
Normalized OD Score: sc h |
0.8479±0.0400073 |
Z-Score: |
-6.5406±2.20991 |
p-Value: |
0.000000321284 |
Z-Factor: |
-2.86974 |
Fitness Defect: |
14.9509 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 9|A8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.80 Celcius | Date: | 2007-11-13 YYYY-MM-DD | Plate CH Control (+): | 0.039724999999999996±0.00061 | Plate DMSO Control (-): | 0.587375±0.07184 | Plate Z-Factor: | 0.5847 |
| png ps pdf |
537925 |
methyl 11-acetyloxyhexadecanoate |
537935 |
methyl 15-acetyloxyhexadecanoate |
537951 |
methyl 10-acetyloxyhexadecanoate |
538065 |
(2,10,13-trimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl) acetate |
538071 |
methyl 4-(3-acetyloxy-10-methyl-12-oxo-2,3,4,5,6,7,8,9,11,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenant hren-17-yl)pentanoate |
538122 |
[10,13-dimethyl-12-oxo-17-(5-oxopentan-2-yl)-1,2,3,4,5,6,7,8,9,11,14,15,16,17-tetradecahydrocyclopenta[a ]phenanthren-3-yl] acetate |
internal high similarity DBLink | Rows returned: 10 | 1 2 Next >> |
active | Cluster 11774 | Additional Members: 14 | Rows returned: 5 | |
|