Compound Information | SONAR Target prediction | Name: | SITOSTERYL ACETATE | Unique Identifier: | SPE00107023 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C31H52O2 | Molecular Weight: | 404.331 g/mol | X log p: | 3.772 (online calculus) | Lipinksi Failures | 0 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 8 | Canonical Smiles: | CCC(CCC(C)C1CCC2C3CC=C4CC(CCC4(C)C3CCC12C)OC(C)=O)C(C)C | Source: | ex widespread in plants | Reference: | J Am Chem Soc 48: 2987 (1926) |
Species: |
4932 |
Condition: |
GIM3 |
Replicates: |
2 |
Raw OD Value: r im |
0.6744±0.00212132 |
Normalized OD Score: sc h |
0.9830±0.00252722 |
Z-Score: |
-0.5395±0.117387 |
p-Value: |
0.590848 |
Z-Factor: |
-10.1373 |
Fitness Defect: |
0.5262 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 2|G5 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.30 Celcius | Date: | 2006-03-15 YYYY-MM-DD | Plate CH Control (+): | 0.03945±0.00165 | Plate DMSO Control (-): | 0.6890499999999999±0.01836 | Plate Z-Factor: | 0.8888 |
| png ps pdf |
7052859 |
[(3S,8S,9R,10R,13S,14S,17E)-17-ethylidene-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclope nta[a]phenanthren-3-yl] acetate |
7052860 |
[(3S,8S,9R,10R,13S,14R,17E)-17-ethylidene-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclope nta[a]phenanthren-3-yl] acetate |
7052861 |
[(3S,8S,9R,10R,13R,14S,17E)-17-ethylidene-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclope nta[a]phenanthren-3-yl] acetate |
7052862 |
[(3S,8S,9R,10R,13R,14R,17E)-17-ethylidene-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclope nta[a]phenanthren-3-yl] acetate |
7052930 |
[(1S)-1-[(3R,5S,8R,9R,10R,17R)-3-acetyloxy-5,10,17-trimethyl-1,2,3,4,6,7,8,9,11,12,15,16-dodecahydrocycl openta[a]phenanthren-17-yl]ethyl] acetate |
7052931 |
[(1S)-1-[(3R,5S,8R,9S,10R,17R)-3-acetyloxy-5,10,17-trimethyl-1,2,3,4,6,7,8,9,11,12,15,16-dodecahydrocycl openta[a]phenanthren-17-yl]ethyl] acetate |
internal high similarity DBLink | Rows returned: 7 | 1 2 Next >> |
active | Cluster 15449 | Additional Members: 9 | Rows returned: 0 | |
|