Compound Information | SONAR Target prediction | Name: | SITOSTERYL ACETATE | Unique Identifier: | SPE00107023 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C31H52O2 | Molecular Weight: | 404.331 g/mol | X log p: | 3.772 (online calculus) | Lipinksi Failures | 0 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 8 | Canonical Smiles: | CCC(CCC(C)C1CCC2C3CC=C4CC(CCC4(C)C3CCC12C)OC(C)=O)C(C)C | Source: | ex widespread in plants | Reference: | J Am Chem Soc 48: 2987 (1926) |
Species: |
4932 |
Condition: |
PAC10 |
Replicates: |
2 |
Raw OD Value: r im |
0.7438±0.025668 |
Normalized OD Score: sc h |
0.9895±0.0136039 |
Z-Score: |
-0.2774±0.35768 |
p-Value: |
0.788202 |
Z-Factor: |
-100.176 |
Fitness Defect: |
0.238 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 2|G5 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.80 Celcius | Date: | 2006-03-14 YYYY-MM-DD | Plate CH Control (+): | 0.0387±0.00112 | Plate DMSO Control (-): | 0.7619±0.02718 | Plate Z-Factor: | 0.8634 |
| png ps pdf |
6954090 |
[(3S,8R,9R,10S,13S,14S,17S)-17-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclo penta[a]phenanthren-3-yl] acetate |
6954091 |
[(3R,8R,9R,10S,13S,14S,17S)-17-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclo penta[a]phenanthren-3-yl] acetate |
6954092 |
[(3S,8R,9R,10S,13S,14S,17R)-17-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclo penta[a]phenanthren-3-yl] acetate |
6954093 |
[(3R,8R,9R,10S,13S,14S,17R)-17-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclo penta[a]phenanthren-3-yl] acetate |
6973937 |
[(3R,8R,9R,10R,13R,14R,17S)-17-(1-hydroxyethyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro -1H-cyclopenta[a]phenanthren-3-yl] acetate |
7000670 |
[(3R,8R,9S,10R,13R,14S,17S)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-d odecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
internal high similarity DBLink | Rows returned: 7 | 1 2 Next >> |
active | Cluster 15449 | Additional Members: 9 | Rows returned: 0 | |
|