| Compound Information | SONAR Target prediction | 
| Name: | FORMONONETIN | 
| Unique Identifier: | SPE00102007  | 
| MolClass: |  Checkout models in ver1.5 and ver1.0 | 
| Molecular Formula: |  | 
| Molecular Weight: | 256.169 g/mol | 
| X log p: | 17.108  (online calculus) | 
| Lipinksi Failures | 1 | 
| TPSA | 35.53 | 
| Hydrogen Bond Donor Count: | 0 | 
| Hydrogen Bond Acceptors Count: | 4 | 
| Rotatable Bond Count: | 2 | 
| Canonical Smiles: | COc1ccc(cc1)C1=COc2cc(O)ccc2C1=O | 
| Class: | isoflavone | 
| Source: | soyabean and clover species | 
| Reference: | J Chem Soc 1933: 274 | 
| Therapeutics: | phytoestrogen |