| Compound Information | SONAR Target prediction |
| Name: | FORMONONETIN |
| Unique Identifier: | SPE00102007 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | |
| Molecular Weight: | 256.169 g/mol |
| X log p: | 17.108 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 35.53 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 4 |
| Rotatable Bond Count: | 2 |
| Canonical Smiles: | COc1ccc(cc1)C1=COc2cc(O)ccc2C1=O |
| Class: | isoflavone |
| Source: | soyabean and clover species |
| Reference: | J Chem Soc 1933: 274 |
| Therapeutics: | phytoestrogen |
| Found: 184 nonactive | as graph: single | with analogs | 1 2 3 4 5 6 7 8 9 10 Next >> [184] |
| Species: | 4932 |
| Condition: | APC9 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.6989±0.0033234 |
| Normalized OD Score: sc h | 0.9746±0.00638326 |
| Z-Score: | -1.3756±0.326037 |
| p-Value: | 0.180214 |
| Z-Factor: | -583.155 |
| Fitness Defect: | 1.7136 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 1 |
| 5280378 | 7-hydroxy-3-(4-methoxyphenyl)chromen-4-one |
| internal high similarity DBLink | Rows returned: 15 | << Back 1 2 3 Next >> |
| SPE00210296 | 0.9750 |
| SPE01500726 | 0.9752 |
| SPE10100004 | 0.9752 |
| RJC 00206 | 0.9831 |
| BTB 12549 | 0.9832 |
| SPE10100003 | 0.9833 |
| active | Cluster 8155 | Additional Members: 16 | Rows returned: 2 |
| SPE00200422 | 0.396551724137931 |
| SPE00201187 | 0.296296296296296 |
Service provided by the
Mike Tyers Laboratory