Compound Information | SONAR Target prediction | Name: | DIGOXIGENIN | Unique Identifier: | SPE00100688 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C23H34O5 | Molecular Weight: | 357.251 g/mol | X log p: | 0.831 (online calculus) | Lipinksi Failures | 0 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 1 | Canonical Smiles: | CC12CCC(O)CC1CCC1C2CC(O)C2(C)C(CCC12O)C1COC(=O)C=1 | Source: | aglycon of digitoxin, thevetin, cerberin, echujin, evomonoside; mp 217-218 | Reference: | J Chem Soc 1954: 2012 | Generic_name: | 4-(3,12,14-TRIHYDROXY-10,13-DIMETHYL-HEX | Chemical_iupac_name: | DIGOXIGENIN | Drug_type: | Experimental | Drugbank_id: | EXPT01244 | Logp: | 2.12 | Drug_category: | Diga16 inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
BCK2 |
Replicates: |
2 |
Raw OD Value: r im |
0.7851±0.000494975 |
Normalized OD Score: sc h |
1.0242±0.00368396 |
Z-Score: |
1.0155±0.0284488 |
p-Value: |
0.309988 |
Z-Factor: |
-1.61377 |
Fitness Defect: |
1.1712 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 2|F7 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.60 Celcius | Date: | 2006-03-29 YYYY-MM-DD | Plate CH Control (+): | 0.03785±0.00189 | Plate DMSO Control (-): | 0.74605±0.01532 | Plate Z-Factor: | 0.9184 |
| png ps pdf |
10574 |
4-[(3S,5S,8R,9S,10R,13R,14S,17S)-3,5,14-trihydroxy-10,13-dimethyl-2,3,4,6,7,8,9,11,12,15,16,17-dodecahyd ro-1H-cyclopenta[a]phenanthren-17-yl]-5H-furan-2-one |
11219 |
4-[(3S,5S,10R,13R,14S,17S)-3,5,14-trihydroxy-10-(hydroxymethyl)-13-methyl-2,3,4,6,7,8,9,11,12,15,16,17-d odecahydro-1H-cyclopenta[a]phenanthren-17-yl]-5H-furan-2-one |
12539 |
4-[(1R,3R,5R,10S,13R,14S,17S)-1,3,14-trihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradec ahydrocyclopenta[a]phenanthren-17-yl]-5H-furan-2-one |
14436 |
4-[(3S,5S,7S,10R,13R,14S,17S)-3,7,14-trihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradec ahydrocyclopenta[a]phenanthren-17-yl]-5H-furan-2-one |
15478 |
4-[(3S,5R,8R,9S,10S,12R,13S,14S,17S)-3,12,14-trihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17- tetradecahydrocyclopenta[a]phenanthren-17-yl]-5H-furan-2-one |
15987 |
4-[(3S,5S,10R,12R,13S,14S,17S)-3,5,12,14-tetrahydroxy-10-(hydroxymethyl)-13-methyl-2,3,4,6,7,8,9,11,12,1 5,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-5H-furan-2-one |
internal high similarity DBLink | Rows returned: 1 | |
active | Cluster 1442 | Additional Members: 8 | Rows returned: 0 | |
|