Compound Information | SONAR Target prediction | Name: | DIGOXIGENIN | Unique Identifier: | SPE00100688 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C23H34O5 | Molecular Weight: | 357.251 g/mol | X log p: | 0.831 (online calculus) | Lipinksi Failures | 0 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 1 | Canonical Smiles: | CC12CCC(O)CC1CCC1C2CC(O)C2(C)C(CCC12O)C1COC(=O)C=1 | Source: | aglycon of digitoxin, thevetin, cerberin, echujin, evomonoside; mp 217-218 | Reference: | J Chem Soc 1954: 2012 | Generic_name: | 4-(3,12,14-TRIHYDROXY-10,13-DIMETHYL-HEX | Chemical_iupac_name: | DIGOXIGENIN | Drug_type: | Experimental | Drugbank_id: | EXPT01244 | Logp: | 2.12 | Drug_category: | Diga16 inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
APC9 |
Replicates: |
2 |
Raw OD Value: r im |
0.7050±0.00820244 |
Normalized OD Score: sc h |
0.9820±0.00643109 |
Z-Score: |
-0.9808±0.364164 |
p-Value: |
0.342564 |
Z-Factor: |
-85.6816 |
Fitness Defect: |
1.0713 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 2|F7 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 21.40 Celcius | Date: | 2007-11-22 YYYY-MM-DD | Plate CH Control (+): | 0.0412±0.00025 | Plate DMSO Control (-): | 0.69275±0.12390 | Plate Z-Factor: | 0.4147 |
| png ps pdf |
7067429 |
4-[(3R,5R,8R,9R,10R,12S,13R,14S,17R)-3,12,14-trihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17- tetradecahydrocyclopenta[a]phenanthren-17-yl]-5H-furan-2-one |
7067430 |
4-[(3R,5R,8R,9R,10S,12S,13R,14S,17R)-3,12,14-trihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17- tetradecahydrocyclopenta[a]phenanthren-17-yl]-5H-furan-2-one |
7067884 |
4-[(3S,5R,8R,9R,10S,12R,13S,14S,17R)-3,12,14-trihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17- tetradecahydrocyclopenta[a]phenanthren-17-yl]-5H-furan-2-one |
7067885 |
4-[(3S,5S,8R,9R,10S,12R,13S,14S,17R)-3,12,14-trihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17- tetradecahydrocyclopenta[a]phenanthren-17-yl]-5H-furan-2-one |
7067886 |
4-[(3S,5R,8R,9S,10S,12R,13S,14S,17R)-3,12,14-trihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17- tetradecahydrocyclopenta[a]phenanthren-17-yl]-5H-furan-2-one |
7067887 |
4-[(3S,5S,8R,9S,10S,12R,13S,14S,17R)-3,12,14-trihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17- tetradecahydrocyclopenta[a]phenanthren-17-yl]-5H-furan-2-one |
internal high similarity DBLink | Rows returned: 1 | |
active | Cluster 1442 | Additional Members: 8 | Rows returned: 0 | |
|