| Compound Information | SONAR Target prediction |  | Name: | DIHYDROXY (3alpha,12alpha)PREGNAN-20-ONE |  | Unique Identifier: | SPE00100652  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 300.223 g/mol |  | X log p: | -0.683  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 17.07 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 3 |  | Rotatable Bond Count: | 1 |  | Canonical Smiles: | CC(=O)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O)C21C |  | Class: | sterol |  | Source: | semisynthetic |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		KEM1 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.5767±0.000141421 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9650±0.00409034 | 
	 
	
		| Z-Score: | 
		-1.4386±0.0927505 | 
	 
	
		| p-Value: | 
		0.151131 | 
	 
	
		| Z-Factor: | 
		-2.11454 | 
	 
	
		| Fitness Defect: | 
		1.8896 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 11|A3 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 24.70 Celcius |  | Date: | 2008-05-08 YYYY-MM-DD |  | Plate CH Control (+): | 0.0411±0.00070 |  | Plate DMSO Control (-): | 0.5879±0.01774 |  | Plate Z-Factor: | 0.9077 |  
  |  png ps pdf |  
 
 
	
		| 1333 | 
		(10-hydroxy-2,3,4,4a,5,6,7,8,8a,9a,10,10a-dodecahydro-1H-anthracen-9-ylidene)oxidanium | 
	 
	
		| 10570 | 
		(3S)-3,11-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthr en-17-one | 
	 
	
		| 28539 | 
		4-hydroxy-4-methyl-cyclohexan-1-one | 
	 
	
		| 36653 | 
		4-hydroxydecalin-1-one | 
	 
	
		| 64184 | 
		5-hydroxyadamantan-2-one | 
	 
	
		| 65529 | 
		(3R,8S,9S,10S,11S,13S,14S)-3,11-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydro cyclopenta[a]phenanthren-17-one | 
	 
 
 | internal high similarity DBLink  | Rows returned: 3 |  |   
 |  active | Cluster 17389 | Additional Members: 4 | Rows returned: 1 |  |   
 
 |