| Compound Information | SONAR Target prediction | | Name: | ANGOLENSIN (R) | | Unique Identifier: | SPE00100616 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 256.169 g/mol | | X log p: | 15.185 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 4 | | Canonical Smiles: | COc1ccc(cc1)C(C)C(=O)c1ccc(O)cc1O | | Class: | aromatic | | Source: | Pericopsis and Pterocarpus spp | | Reference: | J Chem Soc 1959: 2679; 1963: 5573 |
| Species: |
4932 |
| Condition: |
YPT6 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.4276±0.00494975 |
| Normalized OD Score: sc h |
0.7885±0.00505101 |
| Z-Score: |
-5.9182±0.132922 |
| p-Value: |
0.00000000378352 |
| Z-Factor: |
0.44046 |
| Fitness Defect: |
19.3926 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 10|A6 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.60 Celcius | | Date: | 2008-06-05 YYYY-MM-DD | | Plate CH Control (+): | 0.040325±0.00085 | | Plate DMSO Control (-): | 0.52835±0.01786 | | Plate Z-Factor: | 0.9244 |
|  png
ps
pdf |
| DBLink | Rows returned: 3 | |
| 821427 |
(2S)-1-(2,4-dihydroxyphenyl)-2-(4-methoxyphenyl)propan-1-one |
| 821428 |
(2R)-1-(2,4-dihydroxyphenyl)-2-(4-methoxyphenyl)propan-1-one |
| 3584988 |
1-(2,4-dihydroxyphenyl)-2-(4-methoxyphenyl)propan-1-one |
| internal high similarity DBLink | Rows returned: 0 | |
|
