| 
 | Compound Information | SONAR Target prediction |  | Name: | ANGOLENSIN (R) |  | Unique Identifier: | SPE00100616 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 256.169 g/mol |  | X log p: | 15.185  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 26.3 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 4 |  | Rotatable Bond Count: | 4 |  | Canonical Smiles: | COc1ccc(cc1)C(C)C(=O)c1ccc(O)cc1O |  | Class: | aromatic |  | Source: | Pericopsis and Pterocarpus spp |  | Reference: | J  Chem  Soc 1959: 2679; 1963: 5573 | 
 
 
	
		| Species: | 4932 |  
		| Condition: | ROM2 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.6112±0.0135057 |  
		| Normalized OD Score: sc h | 0.9206±0.000090264 |  
		| Z-Score: | -3.5002±0.123617 |  
		| p-Value: | 0.000488338 |  
		| Z-Factor: | -8.88313 |  
		| Fitness Defect: | 7.6245 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 2|E5 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 23.40 Celcius |  | Date: | 2007-11-21 YYYY-MM-DD |  | Plate CH Control (+): | 0.040025±0.00056 |  | Plate DMSO Control (-): | 0.645825±0.11838 |  | Plate Z-Factor: | 0.3954 | 
 |  png ps
 pdf
 | 
 
 | DBLink  | Rows returned: 3 |  | 
 
	
		| 821427 | (2S)-1-(2,4-dihydroxyphenyl)-2-(4-methoxyphenyl)propan-1-one |  
		| 821428 | (2R)-1-(2,4-dihydroxyphenyl)-2-(4-methoxyphenyl)propan-1-one |  
		| 3584988 | 1-(2,4-dihydroxyphenyl)-2-(4-methoxyphenyl)propan-1-one |  
 | internal high similarity DBLink  | Rows returned: 0 |  | 
 
 | active | Cluster 16963 | Additional Members: 14 | Rows returned: 5 |  | 
 
 |