| Compound Information | SONAR Target prediction |  | Name: | ANGOLENSIN (R) |  | Unique Identifier: | SPE00100616  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 256.169 g/mol |  | X log p: | 15.185  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 26.3 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 4 |  | Rotatable Bond Count: | 4 |  | Canonical Smiles: | COc1ccc(cc1)C(C)C(=O)c1ccc(O)cc1O |  | Class: | aromatic |  | Source: | Pericopsis and Pterocarpus spp |  | Reference: | J  Chem  Soc 1959: 2679; 1963: 5573 |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		RAD23 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.6841±0.0046669 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9655±0.00198641 | 
	 
	
		| Z-Score: | 
		-1.7826±0.14248 | 
	 
	
		| p-Value: | 
		0.0761258 | 
	 
	
		| Z-Factor: | 
		-1.50225 | 
	 
	
		| Fitness Defect: | 
		2.5754 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 10|A6 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 23.10 Celcius |  | Date: | 2008-02-15 YYYY-MM-DD |  | Plate CH Control (+): | 0.04055±0.00028 |  | Plate DMSO Control (-): | 0.687075±0.01876 |  | Plate Z-Factor: | 0.9095 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 3 |  |  
 
	
		| 821427 | 
		(2S)-1-(2,4-dihydroxyphenyl)-2-(4-methoxyphenyl)propan-1-one | 
	 
	
		| 821428 | 
		(2R)-1-(2,4-dihydroxyphenyl)-2-(4-methoxyphenyl)propan-1-one | 
	 
	
		| 3584988 | 
		1-(2,4-dihydroxyphenyl)-2-(4-methoxyphenyl)propan-1-one | 
	 
 
 | internal high similarity DBLink  | Rows returned: 0 |  |  
 
 |  active | Cluster 16963 | Additional Members: 14 | Rows returned: 5 |  |   
 
 |