Compound Information | SONAR Target prediction | Name: | ANGOLENSIN (R) | Unique Identifier: | SPE00100616 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 256.169 g/mol | X log p: | 15.185 (online calculus) | Lipinksi Failures | 1 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 4 | Canonical Smiles: | COc1ccc(cc1)C(C)C(=O)c1ccc(O)cc1O | Class: | aromatic | Source: | Pericopsis and Pterocarpus spp | Reference: | J Chem Soc 1959: 2679; 1963: 5573 |
Species: |
4932 |
Condition: |
FKS1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6208±0.0147785 |
Normalized OD Score: sc h |
0.9236±0.0190398 |
Z-Score: |
-2.1373±0.114678 |
p-Value: |
0.0331442 |
Z-Factor: |
-1.23749 |
Fitness Defect: |
3.4069 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 10|A6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.90 Celcius | Date: | 2008-06-04 YYYY-MM-DD | Plate CH Control (+): | 0.041175±0.00164 | Plate DMSO Control (-): | 0.6304500000000001±0.01319 | Plate Z-Factor: | 0.9156 |
| png ps pdf |
DBLink | Rows returned: 3 | |
821427 |
(2S)-1-(2,4-dihydroxyphenyl)-2-(4-methoxyphenyl)propan-1-one |
821428 |
(2R)-1-(2,4-dihydroxyphenyl)-2-(4-methoxyphenyl)propan-1-one |
3584988 |
1-(2,4-dihydroxyphenyl)-2-(4-methoxyphenyl)propan-1-one |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 16963 | Additional Members: 14 | Rows returned: 5 | |
|