| 
 | Compound Information | SONAR Target prediction |  | Name: | EUPHOL ACETATE |  | Unique Identifier: | SPE00100583 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 416.341 g/mol |  | X log p: | 2.885  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 26.3 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 2 |  | Rotatable Bond Count: | 6 |  | Canonical Smiles: | CC(CCC=C(C)C)C1CCC2(C)C3CCC4C(C)(C)C(CCC4(C)C=3CCC12C)OC(C)=O |  | Class: | sterol |  | Source: | Euphorbia spp |  | Reference: | Helv Chim Acta 37: 2306 (1954) | 
 
 
	
		| Species: | 4932 |  
		| Condition: | ARP1 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.7801±0.00127279 |  
		| Normalized OD Score: sc h | 1.0450±0.00711469 |  
		| Z-Score: | 2.2570±0.18526 |  
		| p-Value: | 0.0252194 |  
		| Z-Factor: | -0.35316 |  
		| Fitness Defect: | 3.6801 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 2|D7 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 26.20 Celcius |  | Date: | 2006-03-23 YYYY-MM-DD |  | Plate CH Control (+): | 0.0407±0.00162 |  | Plate DMSO Control (-): | 0.7271000000000001±0.00959 |  | Plate Z-Factor: | 0.9459 | 
 |  png ps
 pdf
 | 
 
 
	
		| 110655 | n/a |  
		| 177801 | [(3S,4aS,6aS,6bS,8aR,11R,12S,12aR,14aR,14bS)-4,4,6a,6b,8a,11,12,14b-octamethyl-2,3,4a,5,7,8,9,10,11,12,1 2a,13,14,14a-tetradecahydro-1H-picen-3-yl] acetate
 |  
		| 181096 | [(3S,4aS,6aS,6bS,8aR,11R,12S,12aR,14bS)-4,4,6a,6b,8a,11,12,14b-octamethyl-2,3,4a,5,6,7,8,9,10,11,12,12a, 13,14-tetradecahydro-1H-picen-3-yl] acetate
 |  
		| 185809 | [(3S,8S,10S,13R,14S,17R)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,5,6,7,8,12,15,16, 17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate
 |  
		| 193352 | [(3S,5S,10S,13S,14R,17R)-10,13-dimethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,4,5,6,7,11,12,14,15,16,17-d odecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate
 |  
		| 259896 | [17-(5,6-dimethylhept-3-en-2-yl)-10,13-dimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[ a]phenanthren-3-yl] acetate
 |  
 | internal high similarity DBLink  | Rows returned: 3 |  | 
 
 | active | Cluster 1278 | Additional Members: 6 | Rows returned: 2 |  | 
 
 |