Compound Information | SONAR Target prediction | Name: | EUPHOL ACETATE | Unique Identifier: | SPE00100583 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 416.341 g/mol | X log p: | 2.885 (online calculus) | Lipinksi Failures | 0 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 6 | Canonical Smiles: | CC(CCC=C(C)C)C1CCC2(C)C3CCC4C(C)(C)C(CCC4(C)C=3CCC12C)OC(C)=O | Class: | sterol | Source: | Euphorbia spp | Reference: | Helv Chim Acta 37: 2306 (1954) |
Species: |
4932 |
Condition: |
CIN2 |
Replicates: |
2 |
Raw OD Value: r im |
0.8621±0.0019799 |
Normalized OD Score: sc h |
1.0516±0.00516052 |
Z-Score: |
2.9107±0.339888 |
p-Value: |
0.0046019 |
Z-Factor: |
-0.50722 |
Fitness Defect: |
5.3813 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 2|D7 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 23.40 Celcius | Date: | 2006-02-14 YYYY-MM-DD | Plate CH Control (+): | 0.03835±0.00098 | Plate DMSO Control (-): | 0.787±0.01574 | Plate Z-Factor: | 0.9347 |
| png ps pdf |
110655 |
n/a |
177801 |
[(3S,4aS,6aS,6bS,8aR,11R,12S,12aR,14aR,14bS)-4,4,6a,6b,8a,11,12,14b-octamethyl-2,3,4a,5,7,8,9,10,11,12,1 2a,13,14,14a-tetradecahydro-1H-picen-3-yl] acetate |
181096 |
[(3S,4aS,6aS,6bS,8aR,11R,12S,12aR,14bS)-4,4,6a,6b,8a,11,12,14b-octamethyl-2,3,4a,5,6,7,8,9,10,11,12,12a, 13,14-tetradecahydro-1H-picen-3-yl] acetate |
185809 |
[(3S,8S,10S,13R,14S,17R)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,5,6,7,8,12,15,16, 17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
193352 |
[(3S,5S,10S,13S,14R,17R)-10,13-dimethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,4,5,6,7,11,12,14,15,16,17-d odecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
259896 |
[17-(5,6-dimethylhept-3-en-2-yl)-10,13-dimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[ a]phenanthren-3-yl] acetate |
internal high similarity DBLink | Rows returned: 3 | |
active | Cluster 1278 | Additional Members: 6 | Rows returned: 2 | |
|