Compound Information | SONAR Target prediction | Name: | EUPHOL ACETATE | Unique Identifier: | SPE00100583 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 416.341 g/mol | X log p: | 2.885 (online calculus) | Lipinksi Failures | 0 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 6 | Canonical Smiles: | CC(CCC=C(C)C)C1CCC2(C)C3CCC4C(C)(C)C(CCC4(C)C=3CCC12C)OC(C)=O | Class: | sterol | Source: | Euphorbia spp | Reference: | Helv Chim Acta 37: 2306 (1954) |
Species: |
4932 |
Condition: |
MRT4 |
Replicates: |
2 |
Raw OD Value: r im |
0.4123±0.0121622 |
Normalized OD Score: sc h |
0.8464±0.0350499 |
Z-Score: |
-5.0160±0.422027 |
p-Value: |
0.00000124648 |
Z-Factor: |
-1.58851 |
Fitness Defect: |
13.5952 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 2|D7 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.80 Celcius | Date: | 2007-08-30 YYYY-MM-DD | Plate CH Control (+): | 0.03949999999999999±0.00059 | Plate DMSO Control (-): | 0.46475±0.05332 | Plate Z-Factor: | 0.4602 |
| png ps pdf |
6710750 |
[(3S,13R,14R)-4,4,10,13,14-pentamethyl-17-(6-methylhept-5-en-2-yl)-2,3,5,6,7,11,12,15,16,17-decahydro-1H -cyclopenta[a]phenanthren-3-yl] acetate |
11825354 |
[4-[(1S,2R,4aR,5R)-5-(2-acetyloxyethyl)-1,2,5-trimethyl-2,3,4,4a,6,7-hexahydronaphthalen-1-yl]-2-methyl- butan-2-yl] acetate |
internal high similarity DBLink | Rows returned: 3 | |
nonactive | Cluster 1278 | Additional Members: 6 | Rows returned: 4 | |
|