Compound Information | SONAR Target prediction | Name: | EUPHOL ACETATE | Unique Identifier: | SPE00100583 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 416.341 g/mol | X log p: | 2.885 (online calculus) | Lipinksi Failures | 0 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 6 | Canonical Smiles: | CC(CCC=C(C)C)C1CCC2(C)C3CCC4C(C)(C)C(CCC4(C)C=3CCC12C)OC(C)=O | Class: | sterol | Source: | Euphorbia spp | Reference: | Helv Chim Acta 37: 2306 (1954) |
Species: |
4932 |
Condition: |
APC9 |
Replicates: |
2 |
Raw OD Value: r im |
0.7573±0.000282843 |
Normalized OD Score: sc h |
1.0546±0.00565091 |
Z-Score: |
2.9699±0.35177 |
p-Value: |
0.00389692 |
Z-Factor: |
-6.00316 |
Fitness Defect: |
5.5476 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 2|D7 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 21.40 Celcius | Date: | 2007-11-22 YYYY-MM-DD | Plate CH Control (+): | 0.0412±0.00025 | Plate DMSO Control (-): | 0.69275±0.12390 | Plate Z-Factor: | 0.4147 |
| png ps pdf |
6710750 |
[(3S,13R,14R)-4,4,10,13,14-pentamethyl-17-(6-methylhept-5-en-2-yl)-2,3,5,6,7,11,12,15,16,17-decahydro-1H -cyclopenta[a]phenanthren-3-yl] acetate |
11825354 |
[4-[(1S,2R,4aR,5R)-5-(2-acetyloxyethyl)-1,2,5-trimethyl-2,3,4,4a,6,7-hexahydronaphthalen-1-yl]-2-methyl- butan-2-yl] acetate |
internal high similarity DBLink | Rows returned: 3 | |
active | Cluster 1278 | Additional Members: 6 | Rows returned: 2 | |
|