Compound Information | SONAR Target prediction | Name: | EUPHOL ACETATE | Unique Identifier: | SPE00100583 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 416.341 g/mol | X log p: | 2.885 (online calculus) | Lipinksi Failures | 0 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 6 | Canonical Smiles: | CC(CCC=C(C)C)C1CCC2(C)C3CCC4C(C)(C)C(CCC4(C)C=3CCC12C)OC(C)=O | Class: | sterol | Source: | Euphorbia spp | Reference: | Helv Chim Acta 37: 2306 (1954) |
Species: |
4932 |
Condition: |
ROM2 |
Replicates: |
2 |
Raw OD Value: r im |
0.7342±0.000777817 |
Normalized OD Score: sc h |
1.1037±0.0267217 |
Z-Score: |
4.5918±1.3344 |
p-Value: |
0.000132051 |
Z-Factor: |
-3.94461 |
Fitness Defect: |
8.9323 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 2|D7 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 23.40 Celcius | Date: | 2007-11-21 YYYY-MM-DD | Plate CH Control (+): | 0.040025±0.00056 | Plate DMSO Control (-): | 0.645825±0.11838 | Plate Z-Factor: | 0.3954 |
| png ps pdf |
6432817 |
[(3S,10R,13S)-17-[(2S)-5-ethyl-6-methyl-hept-6-en-2-yl]-10,13-dimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dod ecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
6432818 |
[(3S,10R,13S)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H- cyclopenta[a]phenanthren-3-yl] acetate |
6432819 |
[(3S,10R,13S)-17-[(2S)-5,6-dimethylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro -1H-cyclopenta[a]phenanthren-3-yl] acetate |
6452058 |
[(3S,5S,9R,10R,13S,14R,17R)-17-[(E,2S,5S)-5-ethyl-6-methyl-hept-3-en-2-yl]-10,13-dimethyl-2,3,4,5,6,9,11 ,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
6708519 |
[(3S,13S,14S,17S)-4,4,10,13,14-pentamethyl-17-(6-methylhept-5-en-2-yl)-2,3,5,6,7,11,12,15,16,17-decahydr o-1H-cyclopenta[a]phenanthren-3-yl] acetate |
6708626 |
[(14R)-4,4,10,13,14-pentamethyl-17-(6-methylhept-5-en-2-yl)-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclop enta[a]phenanthren-3-yl] acetate |
internal high similarity DBLink | Rows returned: 3 | |
active | Cluster 1278 | Additional Members: 6 | Rows returned: 2 | |
|