| Compound Information | SONAR Target prediction | | Name: | EUPHOL ACETATE | | Unique Identifier: | SPE00100583 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 416.341 g/mol | | X log p: | 2.885 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 2 | | Rotatable Bond Count: | 6 | | Canonical Smiles: | CC(CCC=C(C)C)C1CCC2(C)C3CCC4C(C)(C)C(CCC4(C)C=3CCC12C)OC(C)=O | | Class: | sterol | | Source: | Euphorbia spp | | Reference: | Helv Chim Acta 37: 2306 (1954) |
| Species: |
4932 |
| Condition: |
APC9 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7573±0.000282843 |
| Normalized OD Score: sc h |
1.0546±0.00565091 |
| Z-Score: |
2.9699±0.35177 |
| p-Value: |
0.00389692 |
| Z-Factor: |
-6.00316 |
| Fitness Defect: |
5.5476 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 2|D7 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 21.40 Celcius | | Date: | 2007-11-22 YYYY-MM-DD | | Plate CH Control (+): | 0.0412±0.00025 | | Plate DMSO Control (-): | 0.69275±0.12390 | | Plate Z-Factor: | 0.4147 |
|  png
ps
pdf |
| 6427341 |
[(3S,4S,10S,13S)-4,10,13-trimethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,4,5,6,7,11,12,14,15,16,17-dodecahyd
ro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| 6427345 |
[(5S,13S,14S,17S)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,5,6,9,11,12,15,16,17-dec
ahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| 6427346 |
[(3S,10S,13R,14R)-4,4,10,13,14-pentamethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,5,6,9,11,12,15,16,17-decahy
dro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| 6427347 |
[(5S,13S,14S,17S)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,5,6,9,11,12,15,16,17-decahy
dro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| 6427349 |
[(5S,13S,14S,17S)-4,4,10,13,14-pentamethyl-17-(6-methylhept-5-en-2-yl)-2,3,5,6,9,11,12,15,16,17-decahydr
o-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| 6427350 |
[(5S)-17-[(E)-5-ethyl-6-methyl-hept-4-en-2-yl]-10,13-dimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-
1H-cyclopenta[a]phenanthren-3-yl] acetate |
| internal high similarity DBLink | Rows returned: 3 | |
| active | Cluster 1278 | Additional Members: 6 | Rows returned: 2 | |
|
