Compound Information | SONAR Target prediction | Name: | FRAXIDIN METHYL ETHER | Unique Identifier: | SPE00100572 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 224.125 g/mol | X log p: | 7.438 (online calculus) | Lipinksi Failures | 1 | TPSA | 53.99 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 3 | Canonical Smiles: | COc1cc2C=CC(=O)Oc2c(OC)c1OC | Class: | coumarin | Source: | derivative |
Species: |
4932 |
Condition: |
RAD52 |
Replicates: |
2 |
Raw OD Value: r im |
0.5661±0.00572756 |
Normalized OD Score: sc h |
0.9962±0.000271539 |
Z-Score: |
-0.1613±0.0132443 |
p-Value: |
0.871868 |
Z-Factor: |
-23.8353 |
Fitness Defect: |
0.1371 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 2|D3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 22.80 Celcius | Date: | 2007-10-26 YYYY-MM-DD | Plate CH Control (+): | 0.0414±0.00069 | Plate DMSO Control (-): | 0.55845±0.09944 | Plate Z-Factor: | 0.4015 |
| png ps pdf |
DBLink | Rows returned: 2 | |
3083928 |
6,7,8-trimethoxychromen-2-one |
5518297 |
5-hydroxy-7,8-dimethoxy-chromen-2-one |
internal high similarity DBLink | Rows returned: 3 | |
nonactive | Cluster 2974 | Additional Members: 2 | Rows returned: 1 | |
|