| Compound Information | SONAR Target prediction |  | Name: | FRAXIDIN METHYL ETHER |  | Unique Identifier: | SPE00100572  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 224.125 g/mol |  | X log p: | 7.438  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 53.99 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 5 |  | Rotatable Bond Count: | 3 |  | Canonical Smiles: | COc1cc2C=CC(=O)Oc2c(OC)c1OC |  | Class: | coumarin |  | Source: | derivative |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		POL32 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.5667±0.00275772 | 
	 
	
		| Normalized OD Score: sc h | 
		1.0108±0.0244648 | 
	 
	
		| Z-Score: | 
		0.3008±0.682387 | 
	 
	
		| p-Value: | 
		0.644622 | 
	 
	
		| Z-Factor: | 
		-12.4721 | 
	 
	
		| Fitness Defect: | 
		0.4391 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 2|D3 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 22.80 Celcius |  | Date: | 2006-02-16 YYYY-MM-DD |  | Plate CH Control (+): | 0.039375±0.00055 |  | Plate DMSO Control (-): | 0.5645249999999999±0.02470 |  | Plate Z-Factor: | 0.8674 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 2 |  |  
 
	
		| 3083928 | 
		6,7,8-trimethoxychromen-2-one | 
	 
	
		| 5518297 | 
		5-hydroxy-7,8-dimethoxy-chromen-2-one | 
	 
 
 | internal high similarity DBLink  | Rows returned: 3 |  |   
 |  active | Cluster 2974 | Additional Members: 2 | Rows returned: 1 |  |   
 
 |