| Compound Information | SONAR Target prediction | | Name: | FRAXIDIN METHYL ETHER | | Unique Identifier: | SPE00100572 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 224.125 g/mol | | X log p: | 7.438 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 53.99 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 5 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | COc1cc2C=CC(=O)Oc2c(OC)c1OC | | Class: | coumarin | | Source: | derivative |
| Species: |
4932 |
| Condition: |
FET3 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6803±0.00120208 |
| Normalized OD Score: sc h |
0.9744±0.0172651 |
| Z-Score: |
-1.0923±0.772384 |
| p-Value: |
0.34315 |
| Z-Factor: |
-3.14612 |
| Fitness Defect: |
1.0696 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 9|H3 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 22.80 Celcius | | Date: | 2008-01-10 YYYY-MM-DD | | Plate CH Control (+): | 0.04095±0.00097 | | Plate DMSO Control (-): | 0.67845±0.01480 | | Plate Z-Factor: | 0.9305 |
| png ps pdf |
| DBLink | Rows returned: 2 | |
| 3083928 |
6,7,8-trimethoxychromen-2-one |
| 5518297 |
5-hydroxy-7,8-dimethoxy-chromen-2-one |
| internal high similarity DBLink | Rows returned: 3 | |
| active | Cluster 2974 | Additional Members: 2 | Rows returned: 1 | |
|