| 
 | Compound Information | SONAR Target prediction |  | Name: | FRAXIDIN METHYL ETHER |  | Unique Identifier: | SPE00100572 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 224.125 g/mol |  | X log p: | 7.438  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 53.99 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 5 |  | Rotatable Bond Count: | 3 |  | Canonical Smiles: | COc1cc2C=CC(=O)Oc2c(OC)c1OC |  | Class: | coumarin |  | Source: | derivative | 
 
 
	
		| Species: | 4932 |  
		| Condition: | BY4741-2nd |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.6830±0.00247487 |  
		| Normalized OD Score: sc h | 0.9946±0.00347358 |  
		| Z-Score: | 0.5872±0.158308 |  
		| p-Value: | 0.559554 |  
		| Z-Factor: | -8.59878 |  
		| Fitness Defect: | 0.5806 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 9|H3 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 22.00 Celcius |  | Date: | 2008-02-08 YYYY-MM-DD |  | Plate CH Control (+): | 0.04015±0.00045 |  | Plate DMSO Control (-): | 0.688725±0.00800 |  | Plate Z-Factor: | 0.9568 | 
 |  png ps
 pdf
 | 
 
 | DBLink  | Rows returned: 2 |  | 
 
	
		| 3083928 | 6,7,8-trimethoxychromen-2-one |  
		| 5518297 | 5-hydroxy-7,8-dimethoxy-chromen-2-one |  
 | internal high similarity DBLink  | Rows returned: 3 |  | 
 
 | nonactive | Cluster 2974 | Additional Members: 2 | Rows returned: 1 |  | 
 
 |