Compound Information | SONAR Target prediction | Name: | FRAXIDIN METHYL ETHER | Unique Identifier: | SPE00100572 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 224.125 g/mol | X log p: | 7.438 (online calculus) | Lipinksi Failures | 1 | TPSA | 53.99 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 3 | Canonical Smiles: | COc1cc2C=CC(=O)Oc2c(OC)c1OC | Class: | coumarin | Source: | derivative |
Species: |
4932 |
Condition: |
BCK1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6945±0.00905097 |
Normalized OD Score: sc h |
0.9997±0.0050176 |
Z-Score: |
0.4251±0.10557 |
p-Value: |
0.671648 |
Z-Factor: |
-3.17269 |
Fitness Defect: |
0.398 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 9|H3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.10 Celcius | Date: | 2008-05-14 YYYY-MM-DD | Plate CH Control (+): | 0.039875±0.00072 | Plate DMSO Control (-): | 0.697275±0.01500 | Plate Z-Factor: | 0.9315 |
| png ps pdf |
DBLink | Rows returned: 2 | |
3083928 |
6,7,8-trimethoxychromen-2-one |
5518297 |
5-hydroxy-7,8-dimethoxy-chromen-2-one |
internal high similarity DBLink | Rows returned: 3 | |
nonactive | Cluster 2974 | Additional Members: 2 | Rows returned: 1 | |
|