| 
 | Compound Information | SONAR Target prediction |  | Name: | beta-AMYRIN ACETATE |  | Unique Identifier: | SPE00100552 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 416.341 g/mol |  | X log p: | 3.337  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 26.3 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 2 |  | Rotatable Bond Count: | 2 |  | Canonical Smiles: | CC(=O)OC1CCC2(C)C(CCC3(C)C2CC=C2C4CC(C)(C)CCC4(C)CCC23C)C1(C)C |  | Class: | triterpene |  | Source: | latof various species of rubber tree |  | Reference: | J Chem Soc 1952:2916; Phytocehmistry 9: 1669 (1970) | 
 
 
	
		| Species: | 4932 |  
		| Condition: | PPZ1 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.8312±0.000212132 |  
		| Normalized OD Score: sc h | 0.9961±0.00657276 |  
		| Z-Score: | -0.1924±0.326527 |  
		| p-Value: | 0.820692 |  
		| Z-Factor: | -12.0063 |  
		| Fitness Defect: | 0.1976 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 2|C7 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 23.40 Celcius |  | Date: | 2006-05-17 YYYY-MM-DD |  | Plate CH Control (+): | 0.038025±0.00186 |  | Plate DMSO Control (-): | 0.795325±0.01388 |  | Plate Z-Factor: | 0.9574 | 
 |  png ps
 pdf
 | 
 
 
	
		| 26983 | dodec-7-enyl acetate |  
		| 28169 | dodec-9-enyl acetate |  
		| 86893 | tetradec-7-enyl acetate |  
		| 88663 | tetradec-11-enyl acetate |  
		| 92156 | [(3S,4aS,6aR,6bS,8aR,12aR,14aS,14bS)-4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,1 4a-tetradecahydropicen-3-yl] acetate
 |  
		| 92842 | [(3S,4aS,6aR,6bS,8aR,11R,12S,12aR,14aS,14bS)-4,4,6a,6b,8a,11,12,14b-octamethyl-2,3,4a,5,6,7,8,9,10,11,12 ,12a,14,14a-tetradecahydro-1H-picen-3-yl] acetate
 |  
 | internal high similarity DBLink  | Rows returned: 4 |  | 
 
 | nonactive | Cluster 1623 | Additional Members: 8 | Rows returned: 6 |  | 
 
 |