Compound Information | SONAR Target prediction | Name: | beta-AMYRIN ACETATE | Unique Identifier: | SPE00100552 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 416.341 g/mol | X log p: | 3.337 (online calculus) | Lipinksi Failures | 0 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 2 | Canonical Smiles: | CC(=O)OC1CCC2(C)C(CCC3(C)C2CC=C2C4CC(C)(C)CCC4(C)CCC23C)C1(C)C | Class: | triterpene | Source: | latof various species of rubber tree | Reference: | J Chem Soc 1952:2916; Phytocehmistry 9: 1669 (1970) |
Species: |
4932 |
Condition: |
BY4741-2nd |
Replicates: |
2 |
Raw OD Value: r im |
0.9180±0.0019799 |
Normalized OD Score: sc h |
0.9839±0.00207985 |
Z-Score: |
0.3676±0.0692478 |
p-Value: |
0.713526 |
Z-Factor: |
-22.021 |
Fitness Defect: |
0.3375 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum_ED | Plate Number and Position: | 14|H4 | Drug Concentration: | 50.00 nM | OD Absorbance: | 595 nm | Robot Temperature: | 30.00 Celcius | Date: | 2012-05-28 YYYY-MM-DD | Plate CH Control (+): | 0.09250000000000001±0.00457 | Plate DMSO Control (-): | 0.9265000000000002±0.02572 | Plate Z-Factor: | 0.8910 |
| png ps pdf |
371620 |
n/a |
537541 |
dec-7-enyl acetate |
540406 |
(4,4,6a,8a,11,12,14b-heptamethyl-1,2,3,4a,5,6,6b,7,8,9,10,11,12,12a,14,14a-hexadecahydropicen-3-yl) acetate |
549937 |
[17-(5,6-dimethylhept-3-en-2-yl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cycl openta[a]phenanthren-3-yl] acetate |
595275 |
n/a |
595382 |
n/a |
internal high similarity DBLink | Rows returned: 4 | |
active | Cluster 1623 | Additional Members: 8 | Rows returned: 5 | |
|