| Compound Information | SONAR Target prediction | | Name: | beta-AMYRIN ACETATE | | Unique Identifier: | SPE00100552 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 416.341 g/mol | | X log p: | 3.337 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 2 | | Rotatable Bond Count: | 2 | | Canonical Smiles: | CC(=O)OC1CCC2(C)C(CCC3(C)C2CC=C2C4CC(C)(C)CCC4(C)CCC23C)C1(C)C | | Class: | triterpene | | Source: | latof various species of rubber tree | | Reference: | J Chem Soc 1952:2916; Phytocehmistry 9: 1669 (1970) |
| Species: |
4932 |
| Condition: |
BIM1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6608±0.00700036 |
| Normalized OD Score: sc h |
0.9921±0.0080856 |
| Z-Score: |
-0.3917±0.381184 |
| p-Value: |
0.70559 |
| Z-Factor: |
-12.6222 |
| Fitness Defect: |
0.3487 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 12|A4 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.20 Celcius | | Date: | 2008-06-24 YYYY-MM-DD | | Plate CH Control (+): | 0.0407±0.00173 | | Plate DMSO Control (-): | 0.653225±0.01668 | | Plate Z-Factor: | 0.9040 |
| png ps pdf |
| 7052941 |
[(3S,5R,8R,9R,10S)-10,17,17-trimethyl-2,3,4,5,6,7,8,9,11,12,15,16-dodecahydro-1H-cyclopenta[a]phenanthre n-3-yl] acetate |
| 7056552 |
[(5S,8S,9R,10S,13S,14S,17R)-3-ethyl-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopen ta[a]phenanthren-17-yl] acetate |
| 7056553 |
[(5S,8R,9R,10S,13S,14S,17R)-3-ethyl-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopen ta[a]phenanthren-17-yl] acetate |
| 7056554 |
[(5S,8S,9S,10S,13S,14S,17R)-3-ethyl-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopen ta[a]phenanthren-17-yl] acetate |
| 7056555 |
[(5S,8R,9S,10S,13S,14S,17R)-3-ethyl-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopen ta[a]phenanthren-17-yl] acetate |
| 7056596 |
[(5S,8S,9R,10S,13S,14S,17S)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phe nanthren-17-yl] acetate |
| internal high similarity DBLink | Rows returned: 4 | |
| active | Cluster 1623 | Additional Members: 8 | Rows returned: 5 | |
|