Compound Information | SONAR Target prediction | Name: | beta-AMYRIN ACETATE | Unique Identifier: | SPE00100552 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 416.341 g/mol | X log p: | 3.337 (online calculus) | Lipinksi Failures | 0 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 2 | Canonical Smiles: | CC(=O)OC1CCC2(C)C(CCC3(C)C2CC=C2C4CC(C)(C)CCC4(C)CCC23C)C1(C)C | Class: | triterpene | Source: | latof various species of rubber tree | Reference: | J Chem Soc 1952:2916; Phytocehmistry 9: 1669 (1970) |
Species: |
4932 |
Condition: |
GAS1 |
Replicates: |
2 |
Raw OD Value: r im |
0.3553±0.0258094 |
Normalized OD Score: sc h |
1.1125±0.0460773 |
Z-Score: |
1.0982±0.342659 |
p-Value: |
0.286066 |
Z-Factor: |
-2.94416 |
Fitness Defect: |
1.2515 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 2|C7 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 22.90 Celcius | Date: | 2006-01-20 YYYY-MM-DD | Plate CH Control (+): | 0.0424±0.00386 | Plate DMSO Control (-): | 0.356525±0.04945 | Plate Z-Factor: | 0.3953 |
| png ps pdf |
6431469 |
[(E)-hexadec-12-enyl] acetate |
6431473 |
[(E)-hexadec-6-enyl] acetate |
6432820 |
[(3S,10R,13R)-17-[(2S,5R)-5-ethyl-6-methyl-heptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,9,11,12,15,16,17-dode cahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
6432821 |
[(3S,10R,13R)-17-[(2S,5S)-5-ethyl-6-methyl-heptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,9,11,12,15,16,17-dode cahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
6441107 |
dodecan-1-ol; [(E)-dodec-8-enyl] acetate |
6443199 |
[(9E,18E)-tetraconta-9,18-dienyl] acetate |
internal high similarity DBLink | Rows returned: 4 | |
active | Cluster 1623 | Additional Members: 8 | Rows returned: 5 | |
|