| Compound Information | SONAR Target prediction | | Name: | beta-AMYRIN ACETATE | | Unique Identifier: | SPE00100552 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 416.341 g/mol | | X log p: | 3.337 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 2 | | Rotatable Bond Count: | 2 | | Canonical Smiles: | CC(=O)OC1CCC2(C)C(CCC3(C)C2CC=C2C4CC(C)(C)CCC4(C)CCC23C)C1(C)C | | Class: | triterpene | | Source: | latof various species of rubber tree | | Reference: | J Chem Soc 1952:2916; Phytocehmistry 9: 1669 (1970) |
| Species: |
4932 |
| Condition: |
DOC1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.5165±0.00643467 |
| Normalized OD Score: sc h |
1.0074±0.00527168 |
| Z-Score: |
0.2692±0.189037 |
| p-Value: |
0.78963 |
| Z-Factor: |
-9.32026 |
| Fitness Defect: |
0.2362 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 12|A4 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.40 Celcius | | Date: | 2008-05-09 YYYY-MM-DD | | Plate CH Control (+): | 0.040874999999999995±0.00034 | | Plate DMSO Control (-): | 0.51615±0.02389 | | Plate Z-Factor: | 0.8524 |
| png ps pdf |
| 6431469 |
[(E)-hexadec-12-enyl] acetate |
| 6431473 |
[(E)-hexadec-6-enyl] acetate |
| 6432820 |
[(3S,10R,13R)-17-[(2S,5R)-5-ethyl-6-methyl-heptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,9,11,12,15,16,17-dode cahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| 6432821 |
[(3S,10R,13R)-17-[(2S,5S)-5-ethyl-6-methyl-heptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,9,11,12,15,16,17-dode cahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| 6441107 |
dodecan-1-ol; [(E)-dodec-8-enyl] acetate |
| 6443199 |
[(9E,18E)-tetraconta-9,18-dienyl] acetate |
| internal high similarity DBLink | Rows returned: 4 | |
| active | Cluster 1623 | Additional Members: 8 | Rows returned: 5 | |
|