| Compound Information | SONAR Target prediction | | Name: | beta-AMYRIN ACETATE | | Unique Identifier: | SPE00100552 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 416.341 g/mol | | X log p: | 3.337 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 2 | | Rotatable Bond Count: | 2 | | Canonical Smiles: | CC(=O)OC1CCC2(C)C(CCC3(C)C2CC=C2C4CC(C)(C)CCC4(C)CCC23C)C1(C)C | | Class: | triterpene | | Source: | latof various species of rubber tree | | Reference: | J Chem Soc 1952:2916; Phytocehmistry 9: 1669 (1970) |
| Species: |
4932 |
| Condition: |
RIC1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.4418±0.0464569 |
| Normalized OD Score: sc h |
0.9991±0.0461658 |
| Z-Score: |
0.0398±0.566103 |
| p-Value: |
0.689172 |
| Z-Factor: |
-44.6148 |
| Fitness Defect: |
0.3723 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 2|C7 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.50 Celcius | | Date: | 2006-03-17 YYYY-MM-DD | | Plate CH Control (+): | 0.039150000000000004±0.00116 | | Plate DMSO Control (-): | 0.41905000000000003±0.01332 | | Plate Z-Factor: | 0.8746 |
| png ps pdf |
| 5704598 |
[(17E)-10,13-dimethyl-17-propylidene-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenant hren-3-yl] acetate |
| 6427284 |
[(3S,10S,13R)-17-[(2S)-5-ethyl-6-methyl-heptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,16,17-dodecahy dro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| 6427289 |
[(3S,10S,13R)-17-[(E,2R)-5-ethyl-6-methyl-hept-3-en-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16, 17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| 6427299 |
[(5S)-17-(5,6-dimethylheptan-2-yl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,16,17-dodecahydro-1H-cyclopenta[ a]phenanthren-3-yl] acetate |
| 6427300 |
[(3S,5R,10S,13R)-17-[(E,2R)-5-ethyl-6-methyl-hept-3-en-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15, 16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| 6427316 |
n/a |
| internal high similarity DBLink | Rows returned: 4 | |
| active | Cluster 1623 | Additional Members: 8 | Rows returned: 5 | |
|