Compound Information | SONAR Target prediction | Name: | FRIEDELIN | Unique Identifier: | SPE00100551 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 376.32 g/mol | X log p: | 1.503 (online calculus) | Lipinksi Failures | 0 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1C(=O)CCC2C1(C)CCC1C2(C)CCC2(C)C3CC(C)(C)CCC3(C)CCC12C | Class: | triterpene | Source: | Ceratopetalum apetalum D. Don, Cunoniaceae | Reference: | J Chem Soc 1954: 473 | Generic_name: | 5ALPHA-ANDROSTAN-3,17-DIONE | Chemical_iupac_name: | 5ALPHA-ANDROSTAN-3,17-DIONE | Drug_type: | Experimental | Drugbank_id: | EXPT00262 | Drug_category: | Estradiol 17 Beta-Dehydrogenase 1 inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
SLT2 |
Replicates: |
2 |
Raw OD Value: r im |
0.8940±0.0110309 |
Normalized OD Score: sc h |
1.0281±0.0131296 |
Z-Score: |
0.9790±0.649677 |
p-Value: |
0.376854 |
Z-Factor: |
-4.06307 |
Fitness Defect: |
0.9759 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum_ED | Plate Number and Position: | 14|H3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 595 nm | Robot Temperature: | 30.00 Celcius | Date: | 2010-08-10 YYYY-MM-DD | Plate CH Control (+): | 0.0825±0.01155 | Plate DMSO Control (-): | 0.9227499999999998±0.03706 | Plate Z-Factor: | 0.8196 |
| png ps pdf |
443 |
10,13-dimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
454 |
octanal |
984 |
hexadecanal |
2537 |
1,7,7-trimethylnorbornan-2-one |
6986 |
5-methyl-2-propan-2-yl-cyclohexan-1-one |
7016 |
2-cyclohexylcyclohexan-1-one |
internal high similarity DBLink | Rows returned: 17 | 1 2 3 Next >> |
active | Cluster 183 | Additional Members: 2 | Rows returned: 0 | |
|